1,1-dioxo-2-prop-2-ynyl-4H-1λ6,2-benzothiazin-3-one
Modify Date: 2025-08-26 12:31:48
1,1-dioxo-2-prop-2-ynyl-4H-1λ6,2-benzothiazin-3-one structure
|
Common Name | 1,1-dioxo-2-prop-2-ynyl-4H-1λ6,2-benzothiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 31848-19-8 | Molecular Weight | 235.25900 | |
| Density | 1.398g/cm3 | Boiling Point | 403.9ºC at 760mmHg | |
| Molecular Formula | C11H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 1,1-dioxo-2-prop-2-ynyl-4H-1λ6,2-benzothiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760mmHg |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.25900 |
| Flash Point | 198.1ºC |
| Exact Mass | 235.03000 |
| PSA | 62.83000 |
| LogP | 1.41190 |
| Index of Refraction | 1.611 |
| InChIKey | CTZKUHWIUDBFRC-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)Cc2ccccc2S1(=O)=O |
| HS Code | 2914399090 |
|---|
|
~%
1,1-dioxo-2-pro... CAS#:31848-19-8 |
| Literature: Sianesi; Redaelli; Magistretti; Massarani Journal of Medicinal Chemistry, 1973 , vol. 16, # 10 p. 1133 - 1137 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1-dioxo-2-prop-2-ynyl-4H-1 |