N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide
Modify Date: 2025-09-13 16:31:29
![N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide Structure](https://www.chemsrc.com/extcaspic/480/318508-36-0.png)
N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide structure
|
Common Name | N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide | ||
|---|---|---|---|---|
| CAS Number | 318508-36-0 | Molecular Weight | 272.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21N2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21N2P |
|---|---|
| Molecular Weight | 272.32 |
| InChIKey | CJRHICOUZDNEPY-UHFFFAOYSA-N |
| SMILES | CN(C)CCNP(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: Molecular weight of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is 272.32. |
| Q: What is the CAS number of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: CAS number of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is 318508-36-0. |
| Q: What is the InChIKey of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: InChIKey of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is CJRHICOUZDNEPY-UHFFFAOYSA-N. |
| Q: What is the English name of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: The English name of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide. |
| Q: What is the Chinese name of 318508-36-0? |
| A: Chinese name of 318508-36-0 is 318508-36-0. |
| Q: What is the molecular formula of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: Molecular formula of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is C16H21N2P. |
| Q: What is the SMILES notation of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide? |
| A: SMILES notation of N-[2-(Dimethylamino)ethyl]-P,P-diphenylphosphinous amide is CN(C)CCNP(c1ccccc1)c1ccccc1. |