2,3,6-Tribromo-4-methoxy-5-nitropyridine structure
|
Common Name | 2,3,6-Tribromo-4-methoxy-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 31872-70-5 | Molecular Weight | 390.81200 | |
| Density | 2.339g/cm3 | Boiling Point | 351.7ºC at 760 mmHg | |
| Molecular Formula | C6H3Br3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | 2,3,6-Tribromo-4-methoxy-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.339g/cm3 |
|---|---|
| Boiling Point | 351.7ºC at 760 mmHg |
| Molecular Formula | C6H3Br3N2O3 |
| Molecular Weight | 390.81200 |
| Flash Point | 166.5ºC |
| Exact Mass | 387.76900 |
| PSA | 67.94000 |
| LogP | 3.80910 |
| Index of Refraction | 1.646 |
| InChIKey | ZZTYRHRFWFOHQH-UHFFFAOYSA-N |
| SMILES | COc1c(Br)c(Br)nc(Br)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5,6-Tribrom-3-nitro-4-methoxypyridin |