3-Bromo-4-methoxy-5-nitropyridine structure
|
Common Name | 3-Bromo-4-methoxy-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 31872-76-1 | Molecular Weight | 233.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 300.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | 39-40℃ | |
| MSDS | N/A | Flash Point | 135.3±26.5 °C | |
| Name | 3-bromo-4-methoxy-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.1±37.0 °C at 760 mmHg |
| Melting Point | 39-40℃ |
| Molecular Formula | C6H5BrN2O3 |
| Molecular Weight | 233.020 |
| Flash Point | 135.3±26.5 °C |
| Exact Mass | 231.948349 |
| PSA | 67.94000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | UIQZXGXNJIZTOQ-UHFFFAOYSA-N |
| SMILES | COc1c(Br)cncc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| W5376 |
| I02-2135 |
| 3-Bromo-4-methoxy-5-nitropyridine |
| Pyridine, 3-bromo-4-methoxy-5-nitro- |