1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl) structure
|
Common Name | 1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl) | ||
|---|---|---|---|---|
| CAS Number | 319-56-2 | Molecular Weight | 236.21100 | |
| Density | 1.363g/cm3 | Boiling Point | 284.5ºC at 760mmHg | |
| Molecular Formula | C9H7F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.8ºC | |
| Name | 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione |
|---|
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 284.5ºC at 760mmHg |
| Molecular Formula | C9H7F3O2S |
| Molecular Weight | 236.21100 |
| Flash Point | 125.8ºC |
| Exact Mass | 236.01200 |
| PSA | 62.38000 |
| LogP | 2.76070 |
| Index of Refraction | 1.48 |
| InChIKey | RHTCJUAECVTPAS-UHFFFAOYSA-N |
| SMILES | Cc1ccsc1C(=O)CC(=O)C(F)(F)F |
|
~%
1,3-Butanedione... CAS#:319-56-2 |
| Literature: ARGENTA DISCOVERY LIMITED Patent: WO2004/13130 A1, 2004 ; Location in patent: Page 180 ; |
|
~%
1,3-Butanedione... CAS#:319-56-2 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |