1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl)
1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl) structure
|
Common Name | 1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl) | ||
|---|---|---|---|---|
| CAS Number | 319-56-2 | Molecular Weight | 236.21100 | |
| Density | 1.363g/cm3 | Boiling Point | 284.5ºC at 760mmHg | |
| Molecular Formula | C9H7F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.8ºC | |
Summary: 1,3-Butanedione,4,4,4-trifluoro-1-(3-methyl-2-thienyl) (CAS号：319-56-2，分子式：C9H7F3O2S，分子量：236.21100), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 284.5ºC at 760mmHg |
| Molecular Formula | C9H7F3O2S |
| Molecular Weight | 236.21100 |
| Flash Point | 125.8ºC |
| Exact Mass | 236.01200 |
| PSA | 62.38000 |
| LogP | 2.76070 |
| Index of Refraction | 1.48 |
| InChIKey | RHTCJUAECVTPAS-UHFFFAOYSA-N |
| SMILES | Cc1ccsc1C(=O)CC(=O)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3-Butanedione... CAS#:319-56-2 |
| Literature: ARGENTA DISCOVERY LIMITED Patent: WO2004/13130 A1, 2004 ; Location in patent: Page 180 ; |
|
~%
1,3-Butanedione... CAS#:319-56-2 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: CAS number of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 319-56-2. |
| Q: What is the polar surface area (PSA) of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: Polar surface area (PSA) of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 62.38000. |
| Q: What is the Chinese name of 319-56-2? |
| A: Chinese name of 319-56-2 is 319-56-2. |
| Q: What is the InChIKey of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: InChIKey of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is RHTCJUAECVTPAS-UHFFFAOYSA-N. |
| Q: What is the boiling point of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: Boiling point of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 284.5ºC at 760mmHg. |
| Q: What is the English name of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: The English name of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione. |
| Q: What are the upstream materials of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: Related upstream materials(CAS) of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione: 13679-72-6;383-63-1. |
| Q: What is the molecular weight of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: Molecular weight of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 236.21100. |
| Q: What is the LogP of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: LogP of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is 2.76070. |
| Q: What is the SMILES notation of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione? |
| A: SMILES notation of 4,4,4-trifluoro-1-(3-methylthiophen-2-yl)butane-1,3-dione is Cc1ccsc1C(=O)CC(=O)C(F)(F)F. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |