2-(2-Nitrophenyl)ethane-1-sulfonyl chloride
Modify Date: 2026-09-22 05:00:45
2-(2-Nitrophenyl)ethane-1-sulfonyl chloride structure
|
Common Name | 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3192-07-2 | Molecular Weight | 249.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8ClNO4S |
|---|---|
| Molecular Weight | 249.67 |
| InChIKey | BLPDCFYXRGNNNJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CCS(=O)(=O)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: Molecular formula of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is C8H8ClNO4S. |
| Q: What is the Chinese name of 3192-07-2? |
| A: Chinese name of 3192-07-2 is 3192-07-2. |
| Q: What is the CAS number of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: CAS number of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is 3192-07-2. |
| Q: What is the InChIKey of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: InChIKey of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is BLPDCFYXRGNNNJ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: The English name of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride. |
| Q: What is the SMILES notation of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: SMILES notation of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is O=[N+]([O-])c1ccccc1CCS(=O)(=O)Cl. |
| Q: What is the molecular weight of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride? |
| A: Molecular weight of 2-(2-Nitrophenyl)ethane-1-sulfonyl chloride is 249.67. |