Ticarbodine structure
|
Common Name | Ticarbodine | ||
|---|---|---|---|---|
| CAS Number | 31932-09-9 | Molecular Weight | 316.38500 | |
| Density | 1.228g/cm3 | Boiling Point | 348.3ºC at 760mmHg | |
| Molecular Formula | C15H19F3N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | 2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 348.3ºC at 760mmHg |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.38500 |
| Flash Point | 164.5ºC |
| Exact Mass | 316.12200 |
| PSA | 54.40000 |
| LogP | 4.82350 |
| Index of Refraction | 1.55 |
| InChIKey | YTNJAWMNFLIDLW-UHFFFAOYSA-N |
| SMILES | CC1CCCC(C)N1C(=S)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-J4CLF34O60 |
| Ticarbodina [INN-Spanish] |
| Ticarbodina |
| Ticarbodinum [INN-Latin] |
| Ticarbodine |
| Ticarbodine (USAN) |
| Ticarbodinum |