4(3H)-Pyrimidinone,2-(dimethylamino)-6-phenyl- structure
|
Common Name | 4(3H)-Pyrimidinone,2-(dimethylamino)-6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 31937-04-9 | Molecular Weight | 215.25100 | |
| Density | 1.16g/cm3 | Boiling Point | 349ºC at 760 mmHg | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | 2-(dimethylamino)-6-phenyl-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 349ºC at 760 mmHg |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.25100 |
| Flash Point | 164.9ºC |
| Exact Mass | 215.10600 |
| PSA | 49.25000 |
| LogP | 1.91520 |
| Index of Refraction | 1.601 |
| InChIKey | BGWMJHCQQHZCIW-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(-c2ccccc2)cc(=O)[nH]1 |
|
~79%
4(3H)-Pyrimidin... CAS#:31937-04-9 |
| Literature: Skulnick; Ludens; Wendling; Glenn; Rohloff; Smith; Wierenga Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1499 - 1504 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-dimethylamino-6-phenyl-3H-pyrimidin-4-one |