N-(4-iodo-2-methylphenyl)pyridine-3-carboxamide
Modify Date: 2025-08-20 15:51:11
N-(4-iodo-2-methylphenyl)pyridine-3-carboxamide structure
|
Common Name | N-(4-iodo-2-methylphenyl)pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 319428-83-6 | Molecular Weight | 338.14400 | |
| Density | 1.691g/cm3 | Boiling Point | 338.5ºC at 760 mmHg | |
| Molecular Formula | C13H11IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | N-(4-iodo-2-methylphenyl)pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.691g/cm3 |
|---|---|
| Boiling Point | 338.5ºC at 760 mmHg |
| Molecular Formula | C13H11IN2O |
| Molecular Weight | 338.14400 |
| Flash Point | 158.5ºC |
| Exact Mass | 337.99200 |
| PSA | 41.99000 |
| LogP | 3.31990 |
| Index of Refraction | 1.692 |
| InChIKey | GJIODWMWVXVWQE-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)ccc1NC(=O)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ccg-6728 |