diheptyl but-2-enedioate structure
|
Common Name | diheptyl but-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 31983-42-3 | Molecular Weight | 312.44400 | |
| Density | 0.957 g/cm3 | Boiling Point | 389.2ºC at 760 mmHg | |
| Molecular Formula | C18H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | diheptyl but-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.957 g/cm3 |
|---|---|
| Boiling Point | 389.2ºC at 760 mmHg |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.44400 |
| Flash Point | 181.8ºC |
| Exact Mass | 312.23000 |
| PSA | 52.60000 |
| LogP | 4.56980 |
| Index of Refraction | 1.458 |
| InChIKey | KUUZQLFCCOGXKQ-YPKPFQOOSA-N |
| SMILES | CCCCCCCOC(=O)C=CC(=O)OCCCCCCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Maleinsaeurediheptylester |
| Diheptyl maleate |
| Di-n-heptyl maleate |
| Di-n-heptylmaleinsaeureester |