2,4(1H,3H)-Pyrimidinedione, 3,6-dimethyl-5-dimethylamino-1-phenyl-
Modify Date: 2025-10-07 09:39:42
2,4(1H,3H)-Pyrimidinedione, 3,6-dimethyl-5-dimethylamino-1-phenyl- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione, 3,6-dimethyl-5-dimethylamino-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 31992-02-6 | Molecular Weight | 259.30400 | |
| Density | 1.23g/cm3 | Boiling Point | 361.7ºC at 760mmHg | |
| Molecular Formula | C14H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.1ºC | |
| Name | 5-(dimethylamino)-3,6-dimethyl-1-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 361.7ºC at 760mmHg |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.30400 |
| Flash Point | 148.1ºC |
| Exact Mass | 259.13200 |
| PSA | 47.24000 |
| LogP | 0.91060 |
| Index of Refraction | 1.615 |
| InChIKey | QCFFJPDKTFNUHI-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)n(C)c(=O)n1-c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6-Dimethyl-5-dimethylamino-1-phenyluracil |
| 5-dimethylamino-3,6-dimethyl-1-phenyl-1H-pyrimidine-2,4-dione |