1-Boc-4-(3,4-dichlorophenyl)piperazine structure
|
Common Name | 1-Boc-4-(3,4-dichlorophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 319926-92-6 | Molecular Weight | 331.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-propanyl 4-(3,4-dichlorophenyl)-1-piperazinecarboxylat e |
|---|
| Molecular Formula | C15H20Cl2N2O2 |
|---|---|
| Molecular Weight | 331.23800 |
| Exact Mass | 330.09000 |
| PSA | 32.78000 |
| LogP | 4.05340 |
| InChIKey | HVSZSQTXGPWWNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| HS Code | 2933599090 |
|---|
|
~71%
1-Boc-4-(3,4-di... CAS#:319926-92-6 |
| Literature: Torisawa; Nishi; Minamikawa Bioorganic and medicinal chemistry letters, 2000 , vol. 10, # 21 p. 2489 - 2491 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |