2,4-dichloro-5-(trifluoromethyl)benzenamine structure
|
Common Name | 2,4-dichloro-5-(trifluoromethyl)benzenamine | ||
|---|---|---|---|---|
| CAS Number | 320-53-6 | Molecular Weight | 230.015 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 254.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H4Cl2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.4±27.3 °C | |
| Name | 2,4-Dichloro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.0±40.0 °C at 760 mmHg |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.015 |
| Flash Point | 107.4±27.3 °C |
| Exact Mass | 228.967285 |
| PSA | 26.02000 |
| LogP | 4.41 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | YECYUHRFXUFJRV-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c(Cl)cc1Cl |
| Storage condition | 2-8°C |
| HS Code | 2921420090 |
|---|
|
~%
2,4-dichloro-5-... CAS#:320-53-6 |
| Literature: I.G.Farbenind. Patent: FR745293 , 1932 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,6-dichloro-5-ethoxy-pyrimidine |
| 4.6-Dichlor-5-aethoxy-pyrimidin |
| 2,4-dichloro-5-trifluoromethyl-aniline |
| 2,4-Dichloro-5-(trifluoromethyl)aniline |
| 2,4-Dichlor-5-trifluormethyl-anilin |