2,4-dichloro-5-(trifluoromethyl)benzenamine
2,4-dichloro-5-(trifluoromethyl)benzenamine structure
|
Common Name | 2,4-dichloro-5-(trifluoromethyl)benzenamine | ||
|---|---|---|---|---|
| CAS Number | 320-53-6 | Molecular Weight | 230.015 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 254.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H4Cl2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.4±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dichloro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.0±40.0 °C at 760 mmHg |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.015 |
| Flash Point | 107.4±27.3 °C |
| Exact Mass | 228.967285 |
| PSA | 26.02000 |
| LogP | 4.41 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | YECYUHRFXUFJRV-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)c(Cl)cc1Cl |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921420090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dichloro-5-... CAS#:320-53-6 |
| Literature: I.G.Farbenind. Patent: FR745293 , 1932 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,6-dichloro-5-ethoxy-pyrimidine |
| 4.6-Dichlor-5-aethoxy-pyrimidin |
| 2,4-dichloro-5-trifluoromethyl-aniline |
| 2,4-Dichloro-5-(trifluoromethyl)aniline |
| 2,4-Dichlor-5-trifluormethyl-anilin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Polar surface area (PSA) of 2,4-Dichloro-5-(trifluoromethyl)aniline is 26.02000. |
| Q: What are the upstream materials of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Related upstream materials(CAS) of 2,4-Dichloro-5-(trifluoromethyl)aniline: 400-70-4. |
| Q: What is the LogP of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: LogP of 2,4-Dichloro-5-(trifluoromethyl)aniline is 4.41. |
| Q: What is the molecular formula of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Molecular formula of 2,4-Dichloro-5-(trifluoromethyl)aniline is C7H4Cl2F3N. |
| Q: What English synonyms does 2,4-Dichloro-5-(trifluoromethyl)aniline have? |
| A: English synonyms of 2,4-Dichloro-5-(trifluoromethyl)aniline: 4,6-dichloro-5-ethoxy-pyrimidine, 4.6-Dichlor-5-aethoxy-pyrimidin, 2,4-dichloro-5-trifluoromethyl-aniline, 2,4-Dichloro-5-(trifluoromethyl)aniline, 2,4-Dichlor-5-trifluormethyl-anilin. |
| Q: What is the English name of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: The English name of 2,4-Dichloro-5-(trifluoromethyl)aniline is 2,4-Dichloro-5-(trifluoromethyl)aniline. |
| Q: What is the SMILES notation of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: SMILES notation of 2,4-Dichloro-5-(trifluoromethyl)aniline is Nc1cc(C(F)(F)F)c(Cl)cc1Cl. |
| Q: What are the storage conditions for 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Storage conditions for 2,4-Dichloro-5-(trifluoromethyl)aniline: 2-8°C. |
| Q: What is the boiling point of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Boiling point of 2,4-Dichloro-5-(trifluoromethyl)aniline is 254.0±40.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 2,4-Dichloro-5-(trifluoromethyl)aniline? |
| A: Molecular weight of 2,4-Dichloro-5-(trifluoromethyl)aniline is 230.015. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |