diethyl 4-fluorobenzene-1,2-dicarboxylate
diethyl 4-fluorobenzene-1,2-dicarboxylate structure
|
Common Name | diethyl 4-fluorobenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 320-96-7 | Molecular Weight | 240.22800 | |
| Density | 1.186g/cm3 | Boiling Point | 287.3ºC at 760 mmHg | |
| Molecular Formula | C12H13FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 4-fluorobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 287.3ºC at 760 mmHg |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.22800 |
| Flash Point | 123.6ºC |
| Exact Mass | 240.08000 |
| PSA | 52.60000 |
| LogP | 2.17910 |
| Index of Refraction | 1.495 |
| InChIKey | AHUYNJGTOFVLRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(F)cc1C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:319-03-9
CAS#:320-97-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Fluor-phthalsaeure-diaethylester |
| 4-fluoro-phthalic acid diethyl ester |
| Phthalic acid,4-fluoro-,diethyl ester |
| 4-fluoro-1,2-benzenedicarboxylic acid,diethyl ester |
| diethyl 4-fluorophthalate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: LogP of diethyl 4-fluorobenzene-1,2-dicarboxylate is 2.17910. |
| Q: What are the downstream products of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: Related downstream products(CAS) of diethyl 4-fluorobenzene-1,2-dicarboxylate: 319-03-9;320-97-8. |
| Q: What is the molecular formula of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: Molecular formula of diethyl 4-fluorobenzene-1,2-dicarboxylate is C12H13FO4. |
| Q: What is the SMILES notation of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: SMILES notation of diethyl 4-fluorobenzene-1,2-dicarboxylate is CCOC(=O)c1ccc(F)cc1C(=O)OCC. |
| Q: What is the English name of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: The English name of diethyl 4-fluorobenzene-1,2-dicarboxylate is diethyl 4-fluorobenzene-1,2-dicarboxylate. |
| Q: What English synonyms does diethyl 4-fluorobenzene-1,2-dicarboxylate have? |
| A: English synonyms of diethyl 4-fluorobenzene-1,2-dicarboxylate: 4-Fluor-phthalsaeure-diaethylester, 4-fluoro-phthalic acid diethyl ester, Phthalic acid,4-fluoro-,diethyl ester, 4-fluoro-1,2-benzenedicarboxylic acid,diethyl ester, diethyl 4-fluorophthalate. |
| Q: What is the CAS number of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: CAS number of diethyl 4-fluorobenzene-1,2-dicarboxylate is 320-96-7. |
| Q: What is the polar surface area (PSA) of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: Polar surface area (PSA) of diethyl 4-fluorobenzene-1,2-dicarboxylate is 52.60000. |
| Q: What is the boiling point of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: Boiling point of diethyl 4-fluorobenzene-1,2-dicarboxylate is 287.3ºC at 760 mmHg. |
| Q: What is the molecular weight of diethyl 4-fluorobenzene-1,2-dicarboxylate? |
| A: Molecular weight of diethyl 4-fluorobenzene-1,2-dicarboxylate is 240.22800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |