diethyl 4-fluorobenzene-1,2-dicarboxylate
Modify Date: 2025-09-16 18:14:12
diethyl 4-fluorobenzene-1,2-dicarboxylate structure
|
Common Name | diethyl 4-fluorobenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 320-96-7 | Molecular Weight | 240.22800 | |
| Density | 1.186g/cm3 | Boiling Point | 287.3ºC at 760 mmHg | |
| Molecular Formula | C12H13FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.6ºC | |
| Name | diethyl 4-fluorobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 287.3ºC at 760 mmHg |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.22800 |
| Flash Point | 123.6ºC |
| Exact Mass | 240.08000 |
| PSA | 52.60000 |
| LogP | 2.17910 |
| Index of Refraction | 1.495 |
| InChIKey | AHUYNJGTOFVLRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(F)cc1C(=O)OCC |
| HS Code | 2917399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:319-03-9
CAS#:320-97-8| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Fluor-phthalsaeure-diaethylester |
| 4-fluoro-phthalic acid diethyl ester |
| Phthalic acid,4-fluoro-,diethyl ester |
| 4-fluoro-1,2-benzenedicarboxylic acid,diethyl ester |
| diethyl 4-fluorophthalate |