Methanone,bis[4-(diethylamino)phenyl]-, oxime structure
|
Common Name | Methanone,bis[4-(diethylamino)phenyl]-, oxime | ||
|---|---|---|---|---|
| CAS Number | 32001-70-0 | Molecular Weight | 339.47400 | |
| Density | 1.01g/cm3 | Boiling Point | 497.5ºC at 760mmHg | |
| Molecular Formula | C21H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.7ºC | |
| Name | 4,4'-Bis-diaethylamino-benzophenon-oxim |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 497.5ºC at 760mmHg |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.47400 |
| Flash Point | 254.7ºC |
| Exact Mass | 339.23100 |
| PSA | 39.07000 |
| LogP | 4.60560 |
| Index of Refraction | 1.543 |
| InChIKey | MDSZMADSQRPHQY-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(=NO)c2ccc(N(CC)CC)cc2)cc1 |
|
~%
Methanone,bis[4... CAS#:32001-70-0 |
| Literature: Morin; Warner; Poirier Journal of Organic Chemistry, 1956 , vol. 21, p. 616 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4,4'-Bis-diaethylamino-benzophenon-imin,Hydrochlorid |
| C.I. Basic Yellow 37,monohydrochloride |
| 4,4'-carbonimidoylbis(N,N-diethylaniline) monohydrochloride |
| Benzenamine,4,4-carbonimidoylbisN,N-diethyl-,monohydrochloride |
| 4,4'-bis-diethylamino-benzophenone oxime |
| C.I.BASICYELLOW37 |
| 4,4'-bis-diethylamino-benzophenone-imine,hydrochloride |
| MONOHYDROCHLORIDE 4,4''-CARBONIMIDOYLBIS(N,N-DIETHYLBENZENAMINE |