benzyl-decyl-dimethylazanium,bromide
benzyl-decyl-dimethylazanium,bromide structure
|
Common Name | benzyl-decyl-dimethylazanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 32014-84-9 | Molecular Weight | 356.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H34BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl-decyl-dimethylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H34BrN |
|---|---|
| Molecular Weight | 356.38400 |
| Exact Mass | 355.18700 |
| LogP | 2.40770 |
| InChIKey | HUSDIEGEFWRTIN-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[N+](C)(C)Cc1ccccc1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~59%
benzyl-decyl-di... CAS#:32014-84-9 |
| Literature: Kuca, Kamil; Marek, Jan; Stodulka, Petr; Musilek, Kamil; Hanusova, Petra; Hrabinova, Martina; Jun, Daniel Molecules, 2007 , vol. 12, # 10 p. 2341 - 2347 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: 1-Octanol-water partition coefficient, log P of the compound
Source: ChEMBL
Target: N/A
External Id: CHEMBL3282679
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenemethanaminium,N-decyl-N,N-dimethyl-,bromide |
| benzyl-decyl-dimethyl-ammonium bromide |
| decyldimethylbenzylammonium bromide |
| decyldimethylbenzylamine,bromide |
| benzyl dimethyl decyl ammonium bromide |
| N-benzyl-N,N-dimethyldecyl-1-ammonium bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzyl-decyl-dimethylazanium,bromide? |
| A: InChIKey of benzyl-decyl-dimethylazanium,bromide is HUSDIEGEFWRTIN-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 32014-84-9? |
| A: Chinese name of 32014-84-9 is 32014-84-9. |
| Q: What is the molecular formula of benzyl-decyl-dimethylazanium,bromide? |
| A: Molecular formula of benzyl-decyl-dimethylazanium,bromide is C19H34BrN. |
| Q: What is the CAS number of benzyl-decyl-dimethylazanium,bromide? |
| A: CAS number of benzyl-decyl-dimethylazanium,bromide is 32014-84-9. |
| Q: What English synonyms does benzyl-decyl-dimethylazanium,bromide have? |
| A: English synonyms of benzyl-decyl-dimethylazanium,bromide: Benzenemethanaminium,N-decyl-N,N-dimethyl-,bromide, benzyl-decyl-dimethyl-ammonium bromide, decyldimethylbenzylammonium bromide, decyldimethylbenzylamine,bromide, benzyl dimethyl decyl ammonium bromide, N-benzyl-N,N-dimethyldecyl-1-ammonium bromide. |
| Q: What is the LogP of benzyl-decyl-dimethylazanium,bromide? |
| A: LogP of benzyl-decyl-dimethylazanium,bromide is 2.40770. |
| Q: What is the molecular weight of benzyl-decyl-dimethylazanium,bromide? |
| A: Molecular weight of benzyl-decyl-dimethylazanium,bromide is 356.38400. |
| Q: What are the upstream materials of benzyl-decyl-dimethylazanium,bromide? |
| A: Related upstream materials(CAS) of benzyl-decyl-dimethylazanium,bromide: 103-83-3;112-29-8. |
| Q: What is the English name of benzyl-decyl-dimethylazanium,bromide? |
| A: The English name of benzyl-decyl-dimethylazanium,bromide is benzyl-decyl-dimethylazanium,bromide. |
| Q: What is the SMILES notation of benzyl-decyl-dimethylazanium,bromide? |
| A: SMILES notation of benzyl-decyl-dimethylazanium,bromide is CCCCCCCCCC[N+](C)(C)Cc1ccccc1.[Br-]. |