Benzoic acid,2-benzoyl-, 1-methylethyl ester structure
|
Common Name | Benzoic acid,2-benzoyl-, 1-methylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 32017-66-6 | Molecular Weight | 268.30700 | |
| Density | 1.123g/cm3 | Boiling Point | 373.9ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | propan-2-yl 2-benzoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 373.9ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 163.2ºC |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.48280 |
| Index of Refraction | 1.558 |
| InChIKey | BNSGDAIIZKLSFE-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccccc1C(=O)c1ccccc1 |
|
~%
Benzoic acid,2-... CAS#:32017-66-6 |
| Literature: Schaefgen; Verhoek; Newman Journal of the American Chemical Society, 1945 , vol. 67, p. 253,254 |
|
~%
Benzoic acid,2-... CAS#:32017-66-6 |
| Literature: Am. Cyanamid Co. Patent: US2233513 , 1929 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Isopropyl-2-benzoylbenzoat |
| 2-Benzoyl-benzoesaeure-isopropylester |
| 2-benzoyl-benzoic acid isopropyl ester |