Methyl 4-(4-fluorophenoxy)-3-nitrobenzenecarboxylate
Modify Date: 2025-09-04 11:17:46
Methyl 4-(4-fluorophenoxy)-3-nitrobenzenecarboxylate structure
|
Common Name | Methyl 4-(4-fluorophenoxy)-3-nitrobenzenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 320417-11-6 | Molecular Weight | 291.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-(4-fluorophenoxy)-3-nitrobenzenecarboxylate |
|---|
| Molecular Formula | C14H10FNO5 |
|---|---|
| Molecular Weight | 291.23100 |
| Exact Mass | 291.05400 |
| PSA | 81.35000 |
| LogP | 3.83600 |
| InChIKey | VOPSYKKSSYANRA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Oc2ccc(F)cc2)c([N+](=O)[O-])c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |