2-(3,5-Dimethylphenoxy)benzaldehyde structure
|
Common Name | 2-(3,5-Dimethylphenoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 320423-51-6 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 331.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.4±18.1 °C | |
| Name | 2-(3,5-dimethylphenoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.3±30.0 °C at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 140.4±18.1 °C |
| Exact Mass | 226.099380 |
| PSA | 26.30000 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | SZCIXTZUAFRBSJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(Oc2ccccc2C=O)c1 |
| HS Code | 2912499000 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-(3,5-Dimethylphenoxy)benzaldehyde |
| Benzaldehyde, 2-(3,5-dimethylphenoxy)- |
| dimethylphenoxybenzenecarbaldehyde |
| MFCD01568762 |