Methanone,(4-methylphenyl)(3-phenyl-2-oxiranyl)
Methanone,(4-methylphenyl)(3-phenyl-2-oxiranyl) structure
|
Common Name | Methanone,(4-methylphenyl)(3-phenyl-2-oxiranyl) | ||
|---|---|---|---|---|
| CAS Number | 32046-97-2 | Molecular Weight | 238.28100 | |
| Density | 1.181g/cm3 | Boiling Point | 394.1ºC at 760 mmHg | |
| Molecular Formula | C16H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760 mmHg |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 181.1ºC |
| Exact Mass | 238.09900 |
| PSA | 29.60000 |
| LogP | 3.31780 |
| Index of Refraction | 1.607 |
| InChIKey | XMLFNFVRQZKLTI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C2OC2c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![(4-methylphenyl)-[(2S,3R)-3-phenyloxiran-2-yl]methanone structure](https://image.chemsrc.com/caspic/321/189017-49-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 2 | |
CAS#:36734-50-6
CAS#:29329-38-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| trans-1-p-methylphenyl-3-phenyl-2,3-epoxy-1-propanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: SMILES notation of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is Cc1ccc(C(=O)C2OC2c2ccccc2)cc1. |
| Q: What is the polar surface area (PSA) of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: Polar surface area (PSA) of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is 29.60000. |
| Q: What English synonyms does (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone have? |
| A: English synonyms of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone: trans-1-p-methylphenyl-3-phenyl-2,3-epoxy-1-propanone. |
| Q: What is the English name of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: The English name of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone. |
| Q: What is the molecular formula of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: Molecular formula of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is C16H14O2. |
| Q: What is the Chinese name of 32046-97-2? |
| A: Chinese name of 32046-97-2 is 32046-97-2. |
| Q: What are the upstream materials of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: Related upstream materials(CAS) of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone: 4224-96-8;14802-30-3;100-52-7;122-00-9. |
| Q: What are the downstream products of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: Related downstream products(CAS) of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone: 36734-50-6;29329-38-2. |
| Q: What is the LogP of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: LogP of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is 3.31780. |
| Q: What is the boiling point of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone? |
| A: Boiling point of (4-methylphenyl)-(3-phenyloxiran-2-yl)methanone is 394.1ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |