5-chloro-9-(2-chlorophenyl)benzo[f][2]benzofuran-1,3-dione
Modify Date: 2026-08-02 20:12:13
![5-chloro-9-(2-chlorophenyl)benzo[f][2]benzofuran-1,3-dione Structure](https://image.chemsrc.com/caspic/431/32050-00-3.png)
5-chloro-9-(2-chlorophenyl)benzo[f][2]benzofuran-1,3-dione structure
|
Common Name | 5-chloro-9-(2-chlorophenyl)benzo[f][2]benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 32050-00-3 | Molecular Weight | 343.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-9-(2-chlorophenyl)benzo[f][2]benzofuran-1,3-dione |
|---|
| Molecular Formula | C18H8Cl2O3 |
|---|---|
| Molecular Weight | 343.16000 |
| Exact Mass | 341.98500 |
| PSA | 43.37000 |
| LogP | 5.12420 |
| InChIKey | FDBNIBHRHNGZFD-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2c1cc1c(Cl)cccc1c2-c1ccccc1Cl |
|
~%
5-chloro-9-(2-c... CAS#:32050-00-3 |
| Literature: Baddar et al. Journal of the Chemical Society, 1955 , p. 461,464 Journal of the Chemical Society, 1959 , p. 1027,1030 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |