6-methyl-4-(4-methylphenyl)benzo[f][2]benzofuran-1,3-dione structure
|
Common Name | 6-methyl-4-(4-methylphenyl)benzo[f][2]benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 32050-01-4 | Molecular Weight | 302.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-4-(4-methylphenyl)benzo[f][2]benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14O3 |
|---|---|
| Molecular Weight | 302.32300 |
| Exact Mass | 302.09400 |
| PSA | 43.37000 |
| LogP | 4.43420 |
| InChIKey | RZHRNLUCJFMLLN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c3c(cc4ccc(C)cc24)C(=O)OC3=O)cc1 |
|
~%
6-methyl-4-(4-m... CAS#:32050-01-4 |
| Literature: Baddar et al. Journal of the Chemical Society, 1955 , p. 461,464 Journal of the Chemical Society, 1959 , p. 1027,1030 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-methyl-1-p-tolyl-naphthalene-2,3-dicarboxylic acid anhydride |
| 7-Methyl-1-p-tolyl-naphthalin-2,3-dicarbonsaeure-anhydrid |