alpha-Phenylthio-2-thiazoleacetamide structure
|
Common Name | alpha-Phenylthio-2-thiazoleacetamide | ||
|---|---|---|---|---|
| CAS Number | 32081-51-9 | Molecular Weight | 250.34000 | |
| Density | 1.37g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C11H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 2-phenylsulfanyl-2-(1,3-thiazol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.34000 |
| Flash Point | 198ºC |
| Exact Mass | 250.02300 |
| PSA | 110.51000 |
| LogP | 3.61150 |
| Index of Refraction | 1.676 |
| InChIKey | REPXMWRBOBUUCW-UHFFFAOYSA-N |
| SMILES | NC(=O)C(Sc1ccccc1)c1nccs1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-phenyl-2-thiazol-2-yl-thioacetamide |
| 2-Thiazoleethanethioamide,a-phenyl |