N-(4-Anilinophenyl)maleimide structure
|
Common Name | N-(4-Anilinophenyl)maleimide | ||
|---|---|---|---|---|
| CAS Number | 32099-65-3 | Molecular Weight | 264.27900 | |
| Density | 1.346g/cm3 | Boiling Point | 466ºC at 760mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | 161-163 ºC | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | n-(4-anilinophenyl)maleimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 466ºC at 760mmHg |
| Melting Point | 161-163 ºC |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 235.7ºC |
| Exact Mass | 264.09000 |
| PSA | 49.41000 |
| LogP | 2.99760 |
| Index of Refraction | 1.697 |
| InChIKey | KPNYFXUDBVQRNK-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(Nc2ccccc2)cc1 |
| Water Solubility | Practically insoluble (0.015 g/L) (25 ºC) |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Pyrrole-2,5-dione,1-[4-(phenylaMino)phenyl] |