Catechin structure
|
Common Name | Catechin | ||
|---|---|---|---|---|
| CAS Number | 321-01-7 | Molecular Weight | 290.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Catechin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O6 |
|---|---|
| Molecular Weight | 290.27 |
| InChIKey | PFTAWBLQPZVEMU-DZGCQCFKSA-N |
| SMILES | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Catechin? |
| A: The English name of Catechin is Catechin. |
| Q: What is the molecular weight of Catechin? |
| A: Molecular weight of Catechin is 290.27. |
| Q: What is the CAS number of Catechin? |
| A: CAS number of Catechin is 321-01-7. |
| Q: What is the molecular formula of Catechin? |
| A: Molecular formula of Catechin is C15H14O6. |
| Q: What is the Chinese name of 321-01-7? |
| A: Chinese name of 321-01-7 is 321-01-7. |
| Q: What is the InChIKey of Catechin? |
| A: InChIKey of Catechin is PFTAWBLQPZVEMU-DZGCQCFKSA-N. |
| Q: What is the SMILES notation of Catechin? |
| A: SMILES notation of Catechin is C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O. |