3H-Pyrazol-3-one,2,4-dihydro-5-methyl-2-[3-(trifluoromethyl)phenyl]-
Modify Date: 2025-09-25 12:59:48
![3H-Pyrazol-3-one,2,4-dihydro-5-methyl-2-[3-(trifluoromethyl)phenyl]- Structure](https://image.chemsrc.com/caspic/148/321-05-1.png)
3H-Pyrazol-3-one,2,4-dihydro-5-methyl-2-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | 3H-Pyrazol-3-one,2,4-dihydro-5-methyl-2-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 321-05-1 | Molecular Weight | 242.19700 | |
| Density | 1.35g/cm3 | Boiling Point | 346.4ºC at 760mmHg | |
| Molecular Formula | C11H9F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.3ºC | |
| Name | 5-methyl-2-[3-(trifluoromethyl)phenyl]-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760mmHg |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.19700 |
| Flash Point | 163.3ºC |
| Exact Mass | 242.06700 |
| PSA | 32.67000 |
| LogP | 2.31860 |
| Index of Refraction | 1.538 |
| InChIKey | FLRFRVFQDVMRPE-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cccc(C(F)(F)F)c2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
|
~75%
3H-Pyrazol-3-on... CAS#:321-05-1 |
| Literature: Duffy; Darcy; Delorme; Dillon; Eppley; Erickson-Miller; Giampa; Hopson; Huang; Keenan; Lamb; Leong; Liu; Miller; Price; Rosen; Shah; Shaw; Smith; Stark; Tian; Tyree; Wiggall; Zhang; Luengo Journal of Medicinal Chemistry, 2001 , vol. 44, # 22 p. 3730 - 3745 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methyl-1-(3-trifluoromethylphenyl)-3-pyrazolin-5-one |
| 5-methyl-2-(3-trifluoromethyl-phenyl)-2,4-dihydro-pyrazol-3-one |
| 1-(3-Trifluormethylphenyl)-3-methylpyrazolon-5 |
| 1-[3-(Trifluoromethyl)phenyl]-3-methyl-2-pyrazolin-5-one |