1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate
Modify Date: 2025-10-18 16:43:29
1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate structure
|
Common Name | 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate | ||
|---|---|---|---|---|
| CAS Number | 321-40-4 | Molecular Weight | 283.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18FNO4 |
|---|---|
| Molecular Weight | 283.29 |
| InChIKey | MOLPQUSWYQOBEF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)N(C(=O)OC(C)C)c1cccc(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: The English name of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate. |
| Q: What is the SMILES notation of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: SMILES notation of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is CC(C)OC(=O)N(C(=O)OC(C)C)c1cccc(F)c1. |
| Q: What is the InChIKey of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: InChIKey of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is MOLPQUSWYQOBEF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: Molecular formula of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is C14H18FNO4. |
| Q: What is the CAS number of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: CAS number of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is 321-40-4. |
| Q: What is the Chinese name of 321-40-4? |
| A: Chinese name of 321-40-4 is 321-40-4. |
| Q: What is the molecular weight of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate? |
| A: Molecular weight of 1,3-Bis(1-methylethyl) 2-(3-fluorophenyl)imidodicarbonate is 283.29. |