7-(trifluoromethyl)quinolin-5-amine structure
|
Common Name | 7-(trifluoromethyl)quinolin-5-amine | ||
|---|---|---|---|---|
| CAS Number | 321-71-1 | Molecular Weight | 212.17100 | |
| Density | 1.390±0.06 g/cm3(Predicted) | Boiling Point | 315.3±42.0 °C(Predicted) | |
| Molecular Formula | C10H7F3N2 | Melting Point | 145-145.5 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(trifluoromethyl)quinolin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.390±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 315.3±42.0 °C(Predicted) |
| Melting Point | 145-145.5 °C |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.17100 |
| Exact Mass | 212.05600 |
| PSA | 38.91000 |
| LogP | 3.41700 |
| InChIKey | AIWKCHBHDAOYRC-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)cc2ncccc12 |
|
~%
7-(trifluoromet... CAS#:321-71-1 |
| Literature: Belcher et al. Journal of the Chemical Society, 1954 , p. 3846,3849 |
|
~%
7-(trifluoromet... CAS#:321-71-1 |
| Literature: Belcher et al. Journal of the Chemical Society, 1954 , p. 3846,3849 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD22627919 |