1-(3,5,5-trimethyl-2-cyclohexen-1-ylidene)acetone structure
|
Common Name | 1-(3,5,5-trimethyl-2-cyclohexen-1-ylidene)acetone | ||
|---|---|---|---|---|
| CAS Number | 3211-80-1 | Molecular Weight | 178.27100 | |
| Density | 0.953g/cm3 | Boiling Point | 263ºC at 760mmHg | |
| Molecular Formula | C12H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.5ºC | |
| Name | 1-(3,5,5-trimethylcyclohex-2-en-1-ylidene)propan-2-one |
|---|
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 263ºC at 760mmHg |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27100 |
| Flash Point | 109.5ºC |
| Exact Mass | 178.13600 |
| PSA | 17.07000 |
| LogP | 3.26810 |
| Index of Refraction | 1.519 |
| InChIKey | BPMFQXXZWSBLRP-UHFFFAOYSA-N |
| SMILES | CC(=O)C=C1C=C(C)CC(C)(C)C1 |
|
~%
1-(3,5,5-trimet... CAS#:3211-80-1 |
| Literature: Nakanishi, Osamu; Fujitani, Mitsuji; Ichimoto, Itsuo; Ueda, Hiroo Agricultural and Biological Chemistry, 1980 , vol. 44, # 7 p. 1667 - 1668 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |