5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole structure
|
Common Name | 5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 3213-94-3 | Molecular Weight | 173.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-3-(4-methylphenyl)-1H-1,2,4-triazole |
|---|
| Molecular Formula | C10H11N3 |
|---|---|
| Molecular Weight | 173.21400 |
| Exact Mass | 173.09500 |
| PSA | 41.57000 |
| LogP | 2.08850 |
| InChIKey | KVSHFDWFTYTPOG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2n[nH]c(C)n2)cc1 |
| HS Code | 2933990090 |
|---|
|
~70%
5-methyl-3-(4-m... CAS#:3213-94-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: US2010/222336 A1, 2010 ; Location in patent: Page/Page column 6 ; US 20100222336 A1 |
|
~71%
5-methyl-3-(4-m... CAS#:3213-94-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2005/66140 A1, 2005 ; Location in patent: Page/Page column 12 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |