2-nitro-3H-benzo[e]benzimidazole structure
|
Common Name | 2-nitro-3H-benzo[e]benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 32145-16-7 | Molecular Weight | 213.19200 | |
| Density | 1.511g/cm3 | Boiling Point | 511.7ºC at 760 mmHg | |
| Molecular Formula | C11H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 2-nitro-3H-benzo[e]benzimidazole |
|---|
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760 mmHg |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.19200 |
| Flash Point | 263.3ºC |
| Exact Mass | 213.05400 |
| PSA | 74.50000 |
| LogP | 3.14750 |
| Index of Refraction | 1.812 |
| InChIKey | GDPGRWNQPOBNGL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1nc2c(ccc3ccccc32)[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |