Propanedioicacid, 2-chloro-2-(2-propen-1-yl)-, 1,3-dimethyl ester structure
|
Common Name | Propanedioicacid, 2-chloro-2-(2-propen-1-yl)-, 1,3-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 32150-13-3 | Molecular Weight | 206.62400 | |
| Density | 1.186g/cm3 | Boiling Point | 203.2ºC at 760mmHg | |
| Molecular Formula | C8H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 69.5ºC | |
| Name | dimethyl 2-chloro-2-prop-2-enylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 203.2ºC at 760mmHg |
| Molecular Formula | C8H11ClO4 |
| Molecular Weight | 206.62400 |
| Flash Point | 69.5ºC |
| Exact Mass | 206.03500 |
| PSA | 52.60000 |
| LogP | 0.88610 |
| Index of Refraction | 1.454 |
| InChIKey | HSNUZEGZWKNDGZ-UHFFFAOYSA-N |
| SMILES | C=CCC(Cl)(C(=O)OC)C(=O)OC |
|
~%
Propanedioicaci... CAS#:32150-13-3 |
| Literature: Ando,W. et al. Journal of the American Chemical Society, 1972 , vol. 94, p. 3870 - 3876 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dimethyl-allylchloromalonat |
| Dimethyl 2-allyl-2-chlormalonat |