5-(Diethylamino)-3,6-dimethyl-1-phenylpyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 5-(Diethylamino)-3,6-dimethyl-1-phenylpyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 32150-38-2 | Molecular Weight | 287.35700 | |
| Density | 1.18g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C16H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
| Name | 5-(diethylamino)-3,6-dimethyl-1-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.35700 |
| Flash Point | 155.9ºC |
| Exact Mass | 287.16300 |
| PSA | 47.24000 |
| LogP | 1.69080 |
| Index of Refraction | 1.596 |
| InChIKey | HLXIMLMWUHODOU-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c(C)n(-c2ccccc2)c(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-diethylamino-3,6-dimethyl-1-phenyl-1H-pyrimidine-2,4-dione |
| 3,6-Dimethyl-5-diethylamino-1-phenyluracil |