1-cyclohexyl-5-dimethylamino-6-methyl-pyrimidine-2,4-dione structure
|
Common Name | 1-cyclohexyl-5-dimethylamino-6-methyl-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 32150-40-6 | Molecular Weight | 251.32500 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-5-(dimethylamino)-6-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.32500 |
| Exact Mass | 251.16300 |
| PSA | 58.36000 |
| LogP | 1.82850 |
| Index of Refraction | 1.559 |
| InChIKey | MSDZXGWQPGEHBJ-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)[nH]c(=O)n1C1CCCCC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Cyclohexyl-5-dimethylamino-6-methyluracil |
| 1-cyclohexyl-5-dimethylamino-6-methyl-1H-pyrimidine-2,4-dione |