5-(sec-Butylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4(1H,3H)-dione
Modify Date: 2025-09-19 15:17:24
5-(sec-Butylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 5-(sec-Butylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 32150-70-2 | Molecular Weight | 287.35700 | |
| Density | 1.17g/cm3 | Boiling Point | 402.6ºC at 760mmHg | |
| Molecular Formula | C16H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.3ºC | |
| Name | 5-(butan-2-ylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 402.6ºC at 760mmHg |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.35700 |
| Flash Point | 197.3ºC |
| Exact Mass | 287.16300 |
| PSA | 56.03000 |
| LogP | 2.12800 |
| Index of Refraction | 1.588 |
| InChIKey | ZNNFDLJQLKVLRQ-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1c(C)n(C)c(=O)n(-c2ccccc2)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(sec-butylamino)-1,6-dimethyl-3-phenylpyrimidine-2,4(1h,3h)-dione |
| 2,4(1H,3H)-Pyrimidinedione,5-sec-butylamino-1,6-dimethyl-3-phenyl |
| Uracil,5-sec-butylamino-1,6-dimethyl-3-phenyl |
| 5-sec-butylamino-1,6-dimethyl-3-phenyl-1H-pyrimidine-2,4-dione |
| 5-sec-Butylamino-1,6-dimethyl-3-phenyluracil |