(2E)-3-(2-Naphthyl)-2-butenoyl chloride
Modify Date: 2025-08-24 20:51:05
(2E)-3-(2-Naphthyl)-2-butenoyl chloride structure
|
Common Name | (2E)-3-(2-Naphthyl)-2-butenoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 321675-01-8 | Molecular Weight | 230.69000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-3-(2-Naphthyl)-2-butenoyl chloride |
|---|
| Molecular Formula | C14H11ClO |
|---|---|
| Molecular Weight | 230.69000 |
| Exact Mass | 230.05000 |
| PSA | 17.07000 |
| LogP | 4.00850 |
| InChIKey | DBZSKMGYRKKNEZ-CSKARUKUSA-N |
| SMILES | CC(=CC(=O)Cl)c1ccc2ccccc2c1 |
|
~%
(2E)-3-(2-Napht... CAS#:321675-01-8 |
| Literature: Barma; Elayadi, Anissa; Falck; Corey, David R. Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 7 p. 1333 - 1336 |
|
~%
(2E)-3-(2-Napht... CAS#:321675-01-8 |
| Literature: Barma; Elayadi, Anissa; Falck; Corey, David R. Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 7 p. 1333 - 1336 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![Benzoic acid, 2-[[(2E)-3-(2-naphthalenyl)-1-oxo-2-buten-1-yl]amino]-, Methyl ester structure](https://image.chemsrc.com/caspic/350/321674-72-0.png)
CAS#:321674-72-0