methyl N-[4-(methoxycarbonylamino)cyclohexyl]carbamate structure
|
Common Name | methyl N-[4-(methoxycarbonylamino)cyclohexyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 32175-29-4 | Molecular Weight | 230.26100 | |
| Density | 1.15g/cm3 | Boiling Point | 382.1ºC at 760mmHg | |
| Molecular Formula | C10H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | methyl N-[4-(methoxycarbonylamino)cyclohexyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760mmHg |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26100 |
| Flash Point | 184.9ºC |
| Exact Mass | 230.12700 |
| PSA | 76.66000 |
| LogP | 1.79140 |
| Index of Refraction | 1.488 |
| InChIKey | RPCPEKVNPMGVJL-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1CCC(NC(=O)OC)CC1 |
|
~%
methyl N-[4-(me... CAS#:32175-29-4 |
| Literature: Humber,L.G. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 401 - 404 |
|
~%
methyl N-[4-(me... CAS#:32175-29-4 |
| Literature: Curtius Journal fuer Praktische Chemie (Leipzig), 1915 , vol. <2> 91, p. 23 |
| trans-Hexahydro-p-phenylen-bis-(carbamidsaeure-methylester) |
| trans-1.4-bis-methoxycarbonylamino-cyclohexane |
| trans-1.4-Bis-carbomethoxyamino-cyclohexan |
| N,N'-(trans-Cyclohexan-1,4-diyl)-bis-carbamidsaeure-dimethylester,trans-1.4-Bis-carbomethoxyamino-cyclohexan |
| carbamic acid,n,n'-1,4-cyclohexanediylbis-,dimethyl ester |
| trans-1.4-Bis-methoxycarbonylamino-cyclohexan |