1H-Pyrazole-5-carbonitrile,1,3-dimethyl-4-nitro structure
|
Common Name | 1H-Pyrazole-5-carbonitrile,1,3-dimethyl-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 32183-13-4 | Molecular Weight | 166.13700 | |
| Density | 1.42g/cm3 | Boiling Point | 358.7ºC at 760mmHg | |
| Molecular Formula | C6H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | 2,5-dimethyl-4-nitropyrazole-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 358.7ºC at 760mmHg |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.13700 |
| Flash Point | 170.7ºC |
| Exact Mass | 166.04900 |
| PSA | 87.43000 |
| LogP | 1.03158 |
| Index of Refraction | 1.637 |
| InChIKey | HYSDHMFCQHHFGV-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(C#N)c1[N+](=O)[O-] |
| HS Code | 2933199090 |
|---|
|
~%
1H-Pyrazole-5-c... CAS#:32183-13-4 |
| Literature: Warner-Lambert Company Patent: US4666908 A1, 1987 ; |
|
~87%
1H-Pyrazole-5-c... CAS#:32183-13-4 |
| Literature: Hamilton, Harriet W.; Ortwine, Daniel F.; Worth, Donald F.; Bristol, James A. Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 91 - 96 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dimethyl-4-nitro-1H-pyrazole-5-carbonitrile |
| 5-Cyano-1,3-dimethyl-4-nitro-pyrazol |
| 5-Cyan-1,3-dimethyl-4-nitropyrazol |
| 1,3-dimethyl-4-nitro-5-cyano-pyrazole |
| 1,3-dimethyl-4-nitropyrazole-5-carbonitrile |
| 5-cyano-1,3-dimethyl-4-nitropyrazole |
| 2,5-dimethyl-4-nitro-2H-pyrazole-3-carbonitrile |
| EINECS 250-946-5 |