2-ethyl-4,4,4-trifluoro-1-phenylbutane-1,3-dione structure
|
Common Name | 2-ethyl-4,4,4-trifluoro-1-phenylbutane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 322-02-1 | Molecular Weight | 244.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethyl-4,4,4-trifluoro-1-phenylbutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11F3O2 |
|---|---|
| Molecular Weight | 244.21000 |
| Exact Mass | 244.07100 |
| PSA | 34.14000 |
| LogP | 3.02690 |
| InChIKey | VEBYSPOHHARCRL-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccccc1)C(=O)C(F)(F)F |
|
~%
2-ethyl-4,4,4-t... CAS#:322-02-1 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1953 , vol. 75, p. 2059,2061 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Butanedione,2-ethyl-4,4,4-trifluoro-1-phenyl |
| 2-Aethyl-4,4,4-trifluor-1-phenyl-butan-1,3-dion |
| 4,4,4-trifluoro-1-phenyl-2-ethylbutane-1,3-dione |
| 2-ethyl-4,4,4-trifluoro-1-phenyl-butane-1,3-dione |