2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid structure
|
Common Name | 2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 32230-08-3 | Molecular Weight | 215.63400 | |
| Density | 1.324g/cm3 | Boiling Point | 316.165ºC at 760 mmHg | |
| Molecular Formula | C9H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.011ºC | |
| Name | 2-(5-chloropyridin-2-yl)oxy-2-methylpropanoic acid |
|---|
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 316.165ºC at 760 mmHg |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.63400 |
| Flash Point | 145.011ºC |
| Exact Mass | 215.03500 |
| PSA | 59.42000 |
| LogP | 1.97700 |
| Index of Refraction | 1.543 |
| InChIKey | DORYZHTVUAFKQK-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cn1)C(=O)O |
|
~%
2-(5-chloropyri... CAS#:32230-08-3 |
| Literature: MERCK and CO., INC. Patent: WO2007/136571 A1, 2007 ; Location in patent: Page/Page column 42 ; WO 2007/136571 A1 |
|
~%
2-(5-chloropyri... CAS#:32230-08-3 |
| Literature: Lin, Linus S.; Lanza Jr., Thomas J.; Jewell, James P.; Liu, Fing; Shah, Shrenik K.; Qi, Hongbo; Tong, Xinchun; Wang, Junying; Xu, Suoyu S.; Fong, Tung M.; Shen, Chun-Pyn; Lao, Julie; Xiao, Jing Chen; Shearman, Lauren P.; Stribling, D. Sloan; Rosko, Kimberly; Strack, Alison; Marsh, Donald J.; Feng, Yue; Kumar, Sanjeev; Samuel, Koppara; Yin, Wenji; Van Der Ploeg, Lex H. T.; Goulet, Mark T.; Hagmann, William K. Journal of Medicinal Chemistry, 2006 , vol. 49, # 26 p. 7584 - 7587 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |