8-(2,4-dimethoxyphenyl)-8-oxooctanoic acid
Modify Date: 2025-11-25 16:02:17
8-(2,4-dimethoxyphenyl)-8-oxooctanoic acid structure
|
Common Name | 8-(2,4-dimethoxyphenyl)-8-oxooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 32246-84-7 | Molecular Weight | 294.34300 | |
| Density | 1.12g/cm3 | Boiling Point | 485.9ºC at 760 mmHg | |
| Molecular Formula | C16H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 8-(2,4-dimethoxyphenyl)-8-oxooctanoic acid |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760 mmHg |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.34300 |
| Flash Point | 176ºC |
| Exact Mass | 294.14700 |
| PSA | 72.83000 |
| LogP | 3.31170 |
| Index of Refraction | 1.513 |
| InChIKey | VRHROPYHUWDTDR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCCCCC(=O)O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:10027-07-3
CAS#:151-10-0| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |