Acetamide,N,N'-[(4,6-dimethyl-1,3-phenylene)bis(methylene)]bis- (9CI) structure
|
Common Name | Acetamide,N,N'-[(4,6-dimethyl-1,3-phenylene)bis(methylene)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 32280-53-8 | Molecular Weight | 248.32100 | |
| Density | 1.068g/cm3 | Boiling Point | 544ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | N-[[5-(acetamidomethyl)-2,4-dimethylphenyl]methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 544ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 218.1ºC |
| Exact Mass | 248.15200 |
| PSA | 58.20000 |
| LogP | 2.35740 |
| Index of Refraction | 1.527 |
| InChIKey | OBHHXCJJZMCBMO-UHFFFAOYSA-N |
| SMILES | CC(=O)NCc1cc(CNC(C)=O)c(C)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,6-Bis(acetamidomethyl)-m-xylol |
| F3308-2785 |
| 4,6-Bis(acetamidomethyl)-m-xylen |
| n,n'-[(4,6-dimethyl-m-phenylene)dimethylene]bis-acetamide |
| N,N'-diacetyl-1,3-bis(aminomethyl)-4,6-dimethylbenzene |
| N,N'-Diacetyl-4,6-dimethyl-1,3-di-<aminomethyl>-benzol |