N-(4-phenyldiazenylphenyl)benzamide structure
|
Common Name | N-(4-phenyldiazenylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 32299-80-2 | Molecular Weight | 301.34200 | |
| Density | 1.14g/cm3 | Boiling Point | 407.7ºC at 760mmHg | |
| Molecular Formula | C19H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-phenyldiazenylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760mmHg |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.34200 |
| Exact Mass | 301.12200 |
| PSA | 53.82000 |
| LogP | 5.42730 |
| InChIKey | NKCPEECGSZPJBV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(N=Nc2ccccc2)cc1)c1ccccc1 |
| HS Code | 2927000090 |
|---|
|
~%
N-(4-phenyldiaz... CAS#:32299-80-2 |
| Literature: Chattaway Journal of the Chemical Society, 1902 , vol. 81, p. 983 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-{4-[(E)-phenyldiazenyl]phenyl}benzamide |
| 4-Benzoylaminoazobenzol |
| Benzoesaeure-(4-phenylazo-anilid) |
| 4-Benzolazo-N-benzoyl-anilin |
| benzoic acid-(4-phenylazo-anilide) |
| 4'-(Phenylazo)benzanilide |
| 4-Benzamino-azobenzol |