2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol
Modify Date: 2025-08-26 21:03:50
![2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol Structure](https://www.chemsrc.com/extcaspic/363/323-12-6.png)
2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol structure
|
Common Name | 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 323-12-6 | Molecular Weight | 319.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F7NO |
|---|---|
| Molecular Weight | 319.22 |
| InChIKey | UMDSNULGDMFPER-UHFFFAOYSA-N |
| SMILES | OCCN(CC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: Molecular formula of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is C12H12F7NO. |
| Q: What is the English name of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: The English name of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol. |
| Q: What is the molecular weight of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: Molecular weight of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is 319.22. |
| Q: What is the CAS number of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: CAS number of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is 323-12-6. |
| Q: What is the InChIKey of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: InChIKey of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is UMDSNULGDMFPER-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol? |
| A: SMILES notation of 2-[(2,2,3,3,4,4,4-Heptafluorobutyl)phenylamino]ethanol is OCCN(CC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1. |
| Q: What is the Chinese name of 323-12-6? |
| A: Chinese name of 323-12-6 is 323-12-6. |