1-[[4-(diethylamino)anilino]methylidene]naphthalen-2-one structure
|
Common Name | 1-[[4-(diethylamino)anilino]methylidene]naphthalen-2-one | ||
|---|---|---|---|---|
| CAS Number | 32323-38-9 | Molecular Weight | 318.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[4-(diethylamino)anilino]methylidene]naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H22N2O |
|---|---|
| Molecular Weight | 318.41200 |
| Exact Mass | 318.17300 |
| PSA | 32.34000 |
| LogP | 4.65470 |
| InChIKey | REHRPCNPDPURHN-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Cc2c(O)ccc3ccccc23)cc1 |
|
~%
1-[[4-(diethyla... CAS#:32323-38-9 |
| Literature: Mayadeo, M. S.; Salaye, N. V. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 442 - 444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-hydroxy-1-naphthalidene-4'-N-diethylaniline |