Z-Ala-Gly-OH structure
|
Common Name | Z-Ala-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 3235-17-4 | Molecular Weight | 280.27700 | |
| Density | 1.285g/cm3 | Boiling Point | 578.5ºC at 760mmHg | |
| Molecular Formula | C13H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.7ºC | |
| Name | 2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 578.5ºC at 760mmHg |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.27700 |
| Flash Point | 303.7ºC |
| Exact Mass | 280.10600 |
| PSA | 104.73000 |
| LogP | 1.28390 |
| Index of Refraction | 1.55 |
| InChIKey | RNBMQRYMCAVZPN-VIFPVBQESA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NCC(=O)O |
| Storage condition | -20°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 221-791-0 |
| Cbz-Ala-Gly-OH |
| carbobenzyloxy-L-alanylglycine |
| Z-Ala-Gly-OH |
| D863 |