2-[(Dimethoxyphosphinothioyl)thio]succinic acid 4-allyl=1-[2-[(dimethoxyphosphinothioyl)thio]propyl] ester
Modify Date: 2025-09-13 14:26:05
![2-[(Dimethoxyphosphinothioyl)thio]succinic acid 4-allyl=1-[2-[(dimethoxyphosphinothioyl)thio]propyl] ester Structure](https://image.chemsrc.com/caspic/285/32358-07-9.png)
2-[(Dimethoxyphosphinothioyl)thio]succinic acid 4-allyl=1-[2-[(dimethoxyphosphinothioyl)thio]propyl] ester structure
|
Common Name | 2-[(Dimethoxyphosphinothioyl)thio]succinic acid 4-allyl=1-[2-[(dimethoxyphosphinothioyl)thio]propyl] ester | ||
|---|---|---|---|---|
| CAS Number | 32358-07-9 | Molecular Weight | 512.55900 | |
| Density | 1.349g/cm3 | Boiling Point | 540.2ºC at 760 mmHg | |
| Molecular Formula | C14H26O8P2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5ºC | |
| Name | 1-O-(2-dimethoxyphosphinothioylsulfanylpropyl) 4-O-prop-2-enyl 2-dimethoxyphosphinothioylsulfanylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 540.2ºC at 760 mmHg |
| Molecular Formula | C14H26O8P2S4 |
| Molecular Weight | 512.55900 |
| Flash Point | 280.5ºC |
| Exact Mass | 511.99900 |
| PSA | 223.92000 |
| LogP | 5.20820 |
| Index of Refraction | 1.551 |
| InChIKey | MSCUHXPWGRRKKL-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC(C)SP(=S)(OC)OC |
| ENT 25,620 |
| 1-{2-[(dimethoxyphosphorothioyl)sulfanyl]propyl} 4-prop-2-en-1-yl 2-[(dimethoxyphosphorothioyl)sulfanyl]butanedioate |
| Velsicol 58-CS-39 |
| Succinic acid,mercapto-,4-allyl 1-(2-mercaptopropyl) ester,S,S-diester with O,O-dimethylphosphorodithioate |
| Butanedioic acid,2-((dimethoxyphosphinothioyl)thio)-,1-(2-((dimethoxyphosphinothioyl)thio)propyl) 4-(2-propenyl) ester |