N,N-Bis(2-chloroethyl)-4-ethoxyphenethylamine structure
|
Common Name | N,N-Bis(2-chloroethyl)-4-ethoxyphenethylamine | ||
|---|---|---|---|---|
| CAS Number | 32359-24-3 | Molecular Weight | 290.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-bis(2-chloroethyl)-2-(4-ethoxyphenyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21Cl2NO |
|---|---|
| Molecular Weight | 290.22900 |
| Exact Mass | 289.10000 |
| PSA | 12.47000 |
| LogP | 3.40740 |
| InChIKey | LTFGZVPJSSSWNH-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(CCN(CCCl)CCCl)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-p-Ethoxyphenethyl-N,N-di-2-chloroethylamine |
| Benzeneethanamine,N,N-bis(2-chloroethyl)-4-ethoxy |
| Phenethylamine,N,N-bis(2-chloroethyl)-p-ethoxy |
| N,N-Bis-(2-chloroethyl)-p-ethoxyphenethylamine |
| N,N-Bis(2-chloroethyl)-4-ethoxyphenethylamine |