8-[2-(1H-indol-3-yl)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane-7,9-dione structure
|
Common Name | 8-[2-(1H-indol-3-yl)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 32367-47-8 | Molecular Weight | 314.33600 | |
| Density | 1.38g/cm3 | Boiling Point | 599.1ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.1ºC | |
| Name | [2-(2-{[2-(1h-indol-3-yl)ethyl]amino}-2-oxoethyl)-1,3-dioxolan-2-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 599.1ºC at 760 mmHg |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.33600 |
| Flash Point | 316.1ºC |
| Exact Mass | 314.12700 |
| PSA | 71.63000 |
| LogP | 1.54040 |
| Index of Refraction | 1.657 |
| InChIKey | GIAWKDRJTOBMHX-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CC(=O)N1CCc1c[nH]c3ccccc13)OCCO2 |
|
~%
8-[2-(1H-indol-... CAS#:32367-47-8 |
| Literature: Brutcher Jr.; Vanderwerff; Dreikorn The Journal of organic chemistry, 1972 , vol. 37, # 2 p. 297 - 302 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| {2-[(2-indol-3-yl-ethylcarbamoyl)-methyl]-[1,3]dioxolan-2-yl}-acetic acid |
| 8-(2-indol-3-yl-ethyl)-1,4-dioxa-8-aza-spiro[4.5]decane-7,9-dione |