(Z)-tangerine acetate structure
|
Common Name | (Z)-tangerine acetate | ||
|---|---|---|---|---|
| CAS Number | 3239-37-0 | Molecular Weight | 238.36600 | |
| Density | 0.893g/cm3 | Boiling Point | 294ºC at 760mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.5ºC | |
| Name | [(5Z)-6,10-dimethylundeca-5,9-dien-2-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.893g/cm3 |
|---|---|
| Boiling Point | 294ºC at 760mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | 85.5ºC |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 4.41090 |
| Index of Refraction | 1.459 |
| InChIKey | BXGLLMNDXKACMT-RAXLEYEMSA-N |
| SMILES | CC(=O)OC(C)CCC=C(C)CCC=C(C)C |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| EINECS 221-805-5 |
| cis-Geranylacetol-acetat |